cas: 2467-25-6 — see every product listed under this CAS number, including other names
4,4'-Methylenebis(2-methylphenol), ≥95%(GC), ≥95%(GC) (CAS 2467-25-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113P12-100mg |
| cas | 2467-25-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 1g | 3083.60 Pln |
| purity | ≥95%(GC) |
|---|---|
| delivery time | 3 weeks |
4-[(4-hydroxy-3-methylphenyl)methyl]-2-methylphenol (CAS 2467-25-6) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: 4-[(4-hydroxy-3-methylphenyl)methyl]-2-methylphenol. InChIKey: MIFGCULLADMRTF-UHFFFAOYSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 4-[(4-hydroxy-3-methylphenyl)methyl]-2-methylphenol |
| InChIKey | MIFGCULLADMRTF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CC2=CC(=C(C=C2)O)C)O |
Computed by PubChem (NCBI)