cas: 1585-67-7 — see every product listed under this CAS number, including other names
4,4'-Oxalyldibenzoic acid, 98% (CAS 1585-67-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F691089-100MG |
| cas | 1585-67-7 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1164.19 Pln | |
| Fluorochem | 5g | 4105.86 Pln | |
| Fluorochem | 10g | 6865.31 Pln | |
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 1154.69 Pln | |
| Ambeed | 5g | 4030.50 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-[2-(4-carboxyphenyl)-2-oxoacetyl]benzoic acid (CAS 1585-67-7) is a chemical compound with the molecular formula C16H10O6 and a molecular weight of 298.25 g/mol. IUPAC name: 4-[2-(4-carboxyphenyl)-2-oxoacetyl]benzoic acid. InChIKey: BQDSQOCMNSRCGT-UHFFFAOYSA-N.
| Molecular formula | C16H10O6 |
|---|---|
| Molecular weight | 298.25 g/mol |
| IUPAC name | 4-[2-(4-carboxyphenyl)-2-oxoacetyl]benzoic acid |
| InChIKey | BQDSQOCMNSRCGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)