CAS 92967-67-4 appears in our catalog under these names: 4,4'-Oxalyldibenzonitrile, 96%, 96%, 4,4'-Oxalyldibenzonitrile, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[2-(4-cyanophenyl)-2-oxoacetyl]benzonitrile (CAS 92967-67-4) is a chemical compound with the molecular formula C16H8N2O2 and a molecular weight of 260.25 g/mol. IUPAC name: 4-[2-(4-cyanophenyl)-2-oxoacetyl]benzonitrile. InChIKey: MXWFKRLTIMWOFB-UHFFFAOYSA-N.
| Molecular formula | C16H8N2O2 |
|---|---|
| Molecular weight | 260.25 g/mol |
| IUPAC name | 4-[2-(4-cyanophenyl)-2-oxoacetyl]benzonitrile |
| InChIKey | MXWFKRLTIMWOFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(=O)C(=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)