cas: 4919-48-6 — see every product listed under this CAS number, including other names
4,4'-Thiodibenzoic acid, 95%, 95% (CAS 4919-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DSQY-100mg |
| cas | 4919-48-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 947.60 Pln | |
| Chemat | 5g | 2718.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-carboxyphenyl)sulfanylbenzoic acid (CAS 4919-48-6) is a chemical compound with the molecular formula C14H10O4S and a molecular weight of 274.29 g/mol. IUPAC name: 4-(4-carboxyphenyl)sulfanylbenzoic acid. InChIKey: FJXIPWRKSXGKSY-UHFFFAOYSA-N.
| Molecular formula | C14H10O4S |
|---|---|
| Molecular weight | 274.29 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)sulfanylbenzoic acid |
| InChIKey | FJXIPWRKSXGKSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)SC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)