4,4,13,13-Tetraethoxy-3,14-dioxa-8,9-dithia-4,13-disilahexadecane, 12.5-15.5% S
cas: 56706-10-6 — see every product listed under this CAS number, including other names
4,4,13,13-Tetraethoxy-3,14-dioxa-8,9-dithia-4,13-disilahexadecane, 12.5-15.5% S (CAS 56706-10-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A410681-1g |
| cas | 56706-10-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 153.44 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 337.00 Pln | |
| Ambeed | 500g | 515.00 Pln | |
| Ambeed | 1kg | 826.50 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 186.63 Pln | |
| BLDpharm | 100g | 353.23 Pln | |
| BLDpharm | 500g | 503.18 Pln | |
| BLDpharm | 1kg | 814.18 Pln |
properties
| purity | 12.5-15.5% S |
|---|---|
| delivery time | 1-2 weeks |
Triethoxy-[3-(3-triethoxysilylpropyldisulfanyl)propyl]silane (CAS 56706-10-6) is a chemical compound with the molecular formula C18H42O6S2Si2 and a molecular weight of 474.8 g/mol. IUPAC name: triethoxy-[3-(3-triethoxysilylpropyldisulfanyl)propyl]silane. InChIKey: FBBATURSCRIBHN-UHFFFAOYSA-N.
| Molecular formula | C18H42O6S2Si2 |
|---|---|
| Molecular weight | 474.8 g/mol |
| IUPAC name | triethoxy-[3-(3-triethoxysilylpropyldisulfanyl)propyl]silane |
| InChIKey | FBBATURSCRIBHN-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
Computed by PubChem (NCBI)
Synonyms:
4,4,13,13-Tetraethoxy-3,14-dioxa-8,9-dithia-4,13-disilahexadecane, 3,14-Dioxa-8,9-dithia-4,13-disilahexadecane, 4,4,13,13-tetraethoxy-, Bis(triethoxysilylpropyl) disulfide, Bis(triethoxysilylpropyl)disulfide, Bis[3-(triethoxysilyl)propyl]disulfide, triethoxy-[3-(3-triethoxysilylpropyldisulfanyl)propyl]silane, C18H42O6S2Si2, Bis (triethoxysilyl propyl) disulfide, Bis[3-(triethoxysilyl)propyl]-disulfide, bis(3-triethoxysilylpropyl)disulfide