cas: 679-02-7 — see every product listed under this CAS number, including other names
4,4,5,5,6,6,6-Heptafluorohexan-1-ol (CAS 679-02-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010475-250MG |
| cas | 679-02-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 862.21 Pln |
| delivery time | 2-3 weeks |
|---|
4,4,5,5,6,6,6-heptafluorohexan-1-ol (CAS 679-02-7) is a chemical compound with the molecular formula C6H7F7O and a molecular weight of 228.11 g/mol. IUPAC name: 4,4,5,5,6,6,6-heptafluorohexan-1-ol. InChIKey: VACKBPFJJWRSAO-UHFFFAOYSA-N.
| Molecular formula | C6H7F7O |
|---|---|
| Molecular weight | 228.11 g/mol |
| IUPAC name | 4,4,5,5,6,6,6-heptafluorohexan-1-ol |
| InChIKey | VACKBPFJJWRSAO-UHFFFAOYSA-N |
| SMILES | C(CC(C(C(F)(F)F)(F)F)(F)F)CO |
Computed by PubChem (NCBI)