cas: 2226818-91-1 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-((4-nitrobenzyl)oxy)phenyl)-1,3,2-dioxaborolane, 98% (CAS 2226818-91-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1736999-5g |
| cas | 2226818-91-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6508.39 Pln | |
| AmBeed | 10g | 11019.82 Pln | |
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 5g | 4183.96 Pln | |
| Fluorochem | 10g | 6943.41 Pln | |
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 669.20 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,4,5,5-tetramethyl-2-[3-[(4-nitrophenyl)methoxy]phenyl]-1,3,2-dioxaborolane (CAS 2226818-91-1) is a chemical compound with the molecular formula C19H22BNO5 and a molecular weight of 355.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-[(4-nitrophenyl)methoxy]phenyl]-1,3,2-dioxaborolane. InChIKey: DKHOBYKXLXCNFF-UHFFFAOYSA-N.
| Molecular formula | C19H22BNO5 |
|---|---|
| Molecular weight | 355.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-[(4-nitrophenyl)methoxy]phenyl]-1,3,2-dioxaborolane |
| InChIKey | DKHOBYKXLXCNFF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)