cas: 1190235-39-2 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-(trifluoromethyl)benzyl)-1,3,2-dioxaborolane 95% (CAS 1190235-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A325140-100mg |
| cas | 1190235-39-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 715.25 Pln | |
| Ambeed | 5g | 3285.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A325140 |
4,4,5,5-tetramethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3,2-dioxaborolane (CAS 1190235-39-2) is a chemical compound with the molecular formula C14H18BF3O2 and a molecular weight of 286.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3,2-dioxaborolane. InChIKey: JMTFZFYCYAHNQN-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,3,2-dioxaborolane |
| InChIKey | JMTFZFYCYAHNQN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)