cas: 1256358-84-5 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-methyl-5-(trifluoromethyl)phenyl)-1,3,2-dioxaborolane 98% (CAS 1256358-84-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A888614-100mg |
| cas | 1256358-84-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A888614 |
4,4,5,5-tetramethyl-2-[3-methyl-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 1256358-84-5) is a chemical compound with the molecular formula C14H18BF3O2 and a molecular weight of 286.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-methyl-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: HZEQLHMVTFFKNV-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-methyl-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | HZEQLHMVTFFKNV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)