cas: 620595-02-0 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl)-1,3,2-dioxaborolane, 95% (CAS 620595-02-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691719-5G |
| cas | 620595-02-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 815.36 Pln | |
| Fluorochem | 100g | 3090.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane (CAS 620595-02-0) is a chemical compound with the molecular formula C19H29BO4 and a molecular weight of 332.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane. InChIKey: DOMGDCPSUQNREF-UHFFFAOYSA-N.
| Molecular formula | C19H29BO4 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | DOMGDCPSUQNREF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3OC(C(O3)(C)C)(C)C |
Computed by PubChem (NCBI)