4,4,5,5-Tetramethyl-2-(4-(nonyloxy)phenyl)-1,3,2-dioxaborolane, 95+%
cas: 2246802-91-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-(nonyloxy)phenyl)-1,3,2-dioxaborolane, 95+% (CAS 2246802-91-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F865458-100MG |
| cas | 2246802-91-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 336.36 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1577.44 Pln | |
| Ambeed | 25g | 5348.81 Pln | |
| BLDpharm | 100mg | 164.41 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 497.63 Pln | |
| BLDpharm | 5g | 1547.26 Pln | |
| BLDpharm | 25g | 5245.96 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 237.20 Pln |
properties
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4,4,5,5-tetramethyl-2-(4-nonoxyphenyl)-1,3,2-dioxaborolane (CAS 2246802-91-3) is a chemical compound with the molecular formula C21H35BO3 and a molecular weight of 346.3 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-nonoxyphenyl)-1,3,2-dioxaborolane. InChIKey: IUZHJSSMJJBIHK-UHFFFAOYSA-N.
| Molecular formula | C21H35BO3 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-nonoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | IUZHJSSMJJBIHK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCCCCCCCC |
Computed by PubChem (NCBI)