cas: 475250-46-5 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-(trifluoromethyl)benzyl)-1,3,2-dioxaborolane, 97% (CAS 475250-46-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F220503-100MG |
| cas | 475250-46-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 2320.03 Pln | |
| Fluorochem | 10g | 3475.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,2-dioxaborolane (CAS 475250-46-5) is a chemical compound with the molecular formula C14H18BF3O2 and a molecular weight of 286.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,2-dioxaborolane. InChIKey: KHVVNJIGKHWRRS-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O2 |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,2-dioxaborolane |
| InChIKey | KHVVNJIGKHWRRS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)