4,4,5,5-Tetramethyl-2-(5-(trifluoromethyl)benzo[b]thiophen-2-yl)-1,3,2-dioxaborolane, 95+%
cas: 1184850-41-6 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(5-(trifluoromethyl)benzo[b]thiophen-2-yl)-1,3,2-dioxaborolane, 95+% (CAS 1184850-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A552052-100mg |
| cas | 1184850-41-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 976.69 Pln | |
| Ambeed | 250mg | 1944.56 Pln | |
| Ambeed | 1g | 6188.75 Pln | |
| Chemat | 50mg | 530.00 Pln | |
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 1619.60 Pln | |
| Chemat | 1g | 5152.40 Pln | |
| BLDpharm | 50mg | 692.00 Pln | |
| BLDpharm | 100mg | 1064.09 Pln | |
| BLDpharm | 250mg | 2102.62 Pln | |
| BLDpharm | 1g | 6678.78 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
4,4,5,5-tetramethyl-2-[5-(trifluoromethyl)-1-benzothiophen-2-yl]-1,3,2-dioxaborolane (CAS 1184850-41-6) is a chemical compound with the molecular formula C15H16BF3O2S and a molecular weight of 328.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-(trifluoromethyl)-1-benzothiophen-2-yl]-1,3,2-dioxaborolane. InChIKey: PTGDBDNGKFAFLZ-UHFFFAOYSA-N.
| Molecular formula | C15H16BF3O2S |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-(trifluoromethyl)-1-benzothiophen-2-yl]-1,3,2-dioxaborolane |
| InChIKey | PTGDBDNGKFAFLZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(S2)C=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)