4,4,5,5-Tetramethyl-2-(5-nitro-2-(trifluoromethoxy)phenyl)-1,3,2-dioxaborolane, 97%
cas: 2236064-16-5 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(5-nitro-2-(trifluoromethoxy)phenyl)-1,3,2-dioxaborolane, 97% (CAS 2236064-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1546946-100mg |
| cas | 2236064-16-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1577.44 Pln | |
| Ambeed | 25g | 5348.81 Pln | |
| BLDpharm | 100mg | 164.41 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 497.63 Pln | |
| BLDpharm | 5g | 1547.26 Pln | |
| BLDpharm | 25g | 5245.96 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 966.34 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4,4,5,5-tetramethyl-2-[5-nitro-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane (CAS 2236064-16-5) is a chemical compound with the molecular formula C13H15BF3NO5 and a molecular weight of 333.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-nitro-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: AHVZFHUMSLMKBP-UHFFFAOYSA-N.
| Molecular formula | C13H15BF3NO5 |
|---|---|
| Molecular weight | 333.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-nitro-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | AHVZFHUMSLMKBP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])OC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5-Tetramethyl-2-(5-nitro-2-(trifluoromethoxy)phenyl)-1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-[5-nitro-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane, 5-Nitro-2-(trifluoromethoxy)benzene-1-boronic Acid Pinacol ester, 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[5-nitro-2-(trifluoromethoxy)phenyl]-, 4,4,5,5-Tetramethyl-2-(5-nitro-2-(trifluoromet hoxy)phenyl)-1,3,2-dioxaborolane