cas: 1286278-35-0 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(m-pentafluorosulfanylbenzene)-1,3,2-dioxaborolane, 95%, 95% (CAS 1286278-35-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRTZ-100mg |
| cas | 1286278-35-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Pentafluoro-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-lambda6-sulfane (CAS 1286278-35-0) is a chemical compound with the molecular formula C12H16BF5O2S and a molecular weight of 330.13 g/mol. IUPAC name: pentafluoro-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-lambda6-sulfane. InChIKey: ISODYTWOQOJZFY-UHFFFAOYSA-N.
| Molecular formula | C12H16BF5O2S |
|---|---|
| Molecular weight | 330.13 g/mol |
| IUPAC name | pentafluoro-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-lambda6-sulfane |
| InChIKey | ISODYTWOQOJZFY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)