CAS 1338368-18-5 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(selenophen-2-yl)-1,3,2-dioxaborolane, 95%, 4,4,5,5–Tetramethyl–2–(selenophen–2–yl)–1,3,2–dioxaborolane, 4,4,5,5-Tetramethyl-2-(selenophen-2-yl)-1,3,2-dioxaborolane, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 100mg.
4,4,5,5-tetramethyl-2-selenophen-2-yl-1,3,2-dioxaborolane (CAS 1338368-18-5) is a chemical compound with the molecular formula C10H15BO2Se and a molecular weight of 257.01 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-selenophen-2-yl-1,3,2-dioxaborolane. InChIKey: SIVQIXCDMNYYCE-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2Se |
|---|---|
| Molecular weight | 257.01 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-selenophen-2-yl-1,3,2-dioxaborolane |
| InChIKey | SIVQIXCDMNYYCE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C[Se]2 |
Computed by PubChem (NCBI)