4,4,8,8,12,12-Hexamethyl-8,12-dihydro-4H-benzo[1,9]quinolizino[3,4,5,6,7-defg]acridine, 98%
cas: 52066-63-4 — see every product listed under this CAS number, including other names
4,4,8,8,12,12-Hexamethyl-8,12-dihydro-4H-benzo[1,9]quinolizino[3,4,5,6,7-defg]acridine, 98% (CAS 52066-63-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1377838-100mg |
| cas | 52066-63-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 960.00 Pln | |
| Ambeed | 5g | 4364.25 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 5g | 4230.80 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 941.92 Pln | |
| BLDpharm | 5g | 4274.08 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene (CAS 52066-63-4) is a chemical compound with the molecular formula C27H27N and a molecular weight of 365.5 g/mol. IUPAC name: 8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene. InChIKey: DMIGTTJVERVKGJ-UHFFFAOYSA-N.
| Molecular formula | C27H27N |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | 8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene |
| InChIKey | DMIGTTJVERVKGJ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C3C(=CC=C2)C(C4=C5N3C6=C1C=CC=C6C(C5=CC=C4)(C)C)(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
DMIGTTJVERVKGJ-UHFFFAOYSA-N