cas: 124729-98-2 — see every product listed under this CAS number, including other names
4,4′,4′′-Tris(phenyl(m-tolyl)amino)triphenylamine, 95-<97% (CAS 124729-98-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC611-95-97-25g |
| cas | 124729-98-2 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 3963.74 Pln | |
| Hoffman Fine Chemicals | 50g | 6152.08 Pln | |
| Hoffman Fine Chemicals | 100g | 9661.08 Pln | |
| Hoffman Fine Chemicals | 200g | 15275.48 Pln | |
| Hoffman Fine Chemicals | 300g | 18267.70 Pln | |
| Hoffman Fine Chemicals | 400g | 20660.20 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4-N-(3-methylphenyl)-1-N,1-N-bis[4-(N-(3-methylphenyl)anilino)phenyl]-4-N-phenylbenzene-1,4-diamine (CAS 124729-98-2) is a chemical compound with the molecular formula C57H48N4 and a molecular weight of 789.0 g/mol. IUPAC name: 4-N-(3-methylphenyl)-1-N,1-N-bis[4-(N-(3-methylphenyl)anilino)phenyl]-4-N-phenylbenzene-1,4-diamine. InChIKey: DIVZFUBWFAOMCW-UHFFFAOYSA-N.
| Molecular formula | C57H48N4 |
|---|---|
| Molecular weight | 789.0 g/mol |
| IUPAC name | 4-N-(3-methylphenyl)-1-N,1-N-bis[4-(N-(3-methylphenyl)anilino)phenyl]-4-N-phenylbenzene-1,4-diamine |
| InChIKey | DIVZFUBWFAOMCW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N(C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC(=C6)C)C7=CC=C(C=C7)N(C8=CC=CC=C8)C9=CC=CC(=C9)C |
Computed by PubChem (NCBI)