cas: 58473-78-2 — see every product listed under this CAS number, including other names
4,4-(Cyclohexane-1,1-Diyl)Bis(N,N-Di-P-Tolylaniline), 98%, 98% (CAS 58473-78-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB3D-100mg |
| cas | 58473-78-2 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 549.20 Pln | |
| Chemat | 15g | 774.80 Pln | |
| Chemat | 25g | 1216.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-N-[4-[1-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]cyclohexyl]phenyl]-N-(4-methylphenyl)aniline (CAS 58473-78-2) is a chemical compound with the molecular formula C46H46N2 and a molecular weight of 626.9 g/mol. IUPAC name: 4-methyl-N-[4-[1-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]cyclohexyl]phenyl]-N-(4-methylphenyl)aniline. InChIKey: ZOKIJILZFXPFTO-UHFFFAOYSA-N.
| Molecular formula | C46H46N2 |
|---|---|
| Molecular weight | 626.9 g/mol |
| IUPAC name | 4-methyl-N-[4-[1-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]cyclohexyl]phenyl]-N-(4-methylphenyl)aniline |
| InChIKey | ZOKIJILZFXPFTO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C4(CCCCC4)C5=CC=C(C=C5)N(C6=CC=C(C=C6)C)C7=CC=C(C=C7)C |
Computed by PubChem (NCBI)