cas: 203626-80-6 — see every product listed under this CAS number, including other names
4,5,7-Trichloro-2-methylquinoline, 95%, 95% (CAS 203626-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11302F-100mg |
| cas | 203626-80-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,5,7-trichloro-2-methylquinoline (CAS 203626-80-6) is a chemical compound with the molecular formula C10H6Cl3N and a molecular weight of 246.5 g/mol. IUPAC name: 4,5,7-trichloro-2-methylquinoline. InChIKey: DSRVLGATYHLALY-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3N |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 4,5,7-trichloro-2-methylquinoline |
| InChIKey | DSRVLGATYHLALY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=CC(=CC2=N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)