cas: 236750-65-5 — see every product listed under this CAS number, including other names
4,5-Bis(2-methoxyethoxy)-2-nitrobenzonitrile, 97%, 97% (CAS 236750-65-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113O5B-5g |
| cas | 236750-65-5 |
| size | 5g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 294.80 Pln | |
| Chemat | 100g | 765.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,5-bis(2-methoxyethoxy)-2-nitrobenzonitrile (CAS 236750-65-5) is a chemical compound with the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. IUPAC name: 4,5-bis(2-methoxyethoxy)-2-nitrobenzonitrile. InChIKey: JNNCLIICKUIURH-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O6 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | 4,5-bis(2-methoxyethoxy)-2-nitrobenzonitrile |
| InChIKey | JNNCLIICKUIURH-UHFFFAOYSA-N |
| SMILES | COCCOC1=C(C=C(C(=C1)C#N)[N+](=O)[O-])OCCOC |
Computed by PubChem (NCBI)