CAS 942-06-3 appears in our catalog under these names: 4,5-Dichlorophthalic Anhydride, 4,5–Dichlorophthalic Anhydride, 4,5-Dichlorophthalic Anhydride, >98.0%(GC)(T), 4,5-Dichlorophthalic anhydride, 98%, 5,6-Dichloroisobenzofuran-1,3-dione, 97%, 97%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g.
5,6-dichloro-2-benzofuran-1,3-dione (CAS 942-06-3) is a chemical compound with the molecular formula C8H2Cl2O3 and a molecular weight of 217.00 g/mol. IUPAC name: 5,6-dichloro-2-benzofuran-1,3-dione. InChIKey: ULSOWUBMELTORB-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2O3 |
|---|---|
| Molecular weight | 217.00 g/mol |
| IUPAC name | 5,6-dichloro-2-benzofuran-1,3-dione |
| InChIKey | ULSOWUBMELTORB-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)C(=O)OC2=O |
Computed by PubChem (NCBI)