4,5-Difluorophthalonitrile, 95%
cas: 134450-56-9 — see every product listed under this CAS number, including other names
4,5-Difluorophthalonitrile, 95% (CAS 134450-56-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A719698-250mg |
| cas | 134450-56-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1532.94 Pln | |
| Ambeed | 25g | 5265.38 Pln | |
| BLDpharm | 100mg | 142.20 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 436.54 Pln | |
| BLDpharm | 5g | 1647.22 Pln | |
| BLDpharm | 25g | 5673.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4,5-difluorobenzene-1,2-dicarbonitrile (CAS 134450-56-9) is a chemical compound with the molecular formula C8H2F2N2 and a molecular weight of 164.11 g/mol. IUPAC name: 4,5-difluorobenzene-1,2-dicarbonitrile. InChIKey: KNDUBEZZKOOYMJ-UHFFFAOYSA-N.
| Molecular formula | C8H2F2N2 |
|---|---|
| Molecular weight | 164.11 g/mol |
| IUPAC name | 4,5-difluorobenzene-1,2-dicarbonitrile |
| InChIKey | KNDUBEZZKOOYMJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)C#N)C#N |
Computed by PubChem (NCBI)