cas: 19397-74-1 — see every product listed under this CAS number, including other names
4,5-Dihydro-2-(ethoxycarbonyl)naphtho(1,2-b)thiophene, 95%, 95% (CAS 19397-74-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AT81-250mg |
| cas | 19397-74-1 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 2709.20 Pln | |
| Chemat | 1g | 3237.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate (CAS 19397-74-1) is a chemical compound with the molecular formula C15H14O2S and a molecular weight of 258.3 g/mol. IUPAC name: ethyl 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate. InChIKey: VAEWXGXOYMXYFS-UHFFFAOYSA-N.
| Molecular formula | C15H14O2S |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | ethyl 4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate |
| InChIKey | VAEWXGXOYMXYFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C3=CC=CC=C3CC2 |
Computed by PubChem (NCBI)