cas: 1610377-03-1 — see every product listed under this CAS number, including other names
4,5-Dimethyl 1-(2-(4-fluorophenyl)-2-oxoethyl)-1H-1,2,3-triazole-4,5-dicarboxylate, 95% (CAS 1610377-03-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A944171-1g |
| cas | 1610377-03-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6163.36 Pln | |
| AmBeed | 5g | 13018.39 Pln | |
| AmBeed | 250mg | 2439.64 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Dimethyl 1-[2-(4-fluorophenyl)-2-oxoethyl]triazole-4,5-dicarboxylate (CAS 1610377-03-1) is a chemical compound with the molecular formula C14H12FN3O5 and a molecular weight of 321.26 g/mol. IUPAC name: dimethyl 1-[2-(4-fluorophenyl)-2-oxoethyl]triazole-4,5-dicarboxylate. InChIKey: FFIREINYQKOBRZ-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O5 |
|---|---|
| Molecular weight | 321.26 g/mol |
| IUPAC name | dimethyl 1-[2-(4-fluorophenyl)-2-oxoethyl]triazole-4,5-dicarboxylate |
| InChIKey | FFIREINYQKOBRZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=N1)CC(=O)C2=CC=C(C=C2)F)C(=O)OC |
Computed by PubChem (NCBI)