cas: 1204-14-4 — see every product listed under this CAS number, including other names
4,6,8-TRICHLORO-2-METHYLQUINOLINE, 98% (CAS 1204-14-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F793798-250MG |
| cas | 1204-14-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1002.79 Pln | |
| Fluorochem | 5g | 2903.16 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,6,8-trichloro-2-methylquinoline (CAS 1204-14-4) is a chemical compound with the molecular formula C10H6Cl3N and a molecular weight of 246.5 g/mol. IUPAC name: 4,6,8-trichloro-2-methylquinoline. InChIKey: MLCCGRNOVHTMML-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3N |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 4,6,8-trichloro-2-methylquinoline |
| InChIKey | MLCCGRNOVHTMML-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=C(C2=N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)