cas: 168915-00-2 — see every product listed under this CAS number, including other names
4,6-Bis(4-fluorophenyl)pyrimidine, ≥98%, ≥98% (CAS 168915-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112YDB-100mg |
| cas | 168915-00-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 914.00 Pln | |
| Chemat | 250mg | 1062.80 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 4130.00 Pln | |
| Chemat | 10g | 5781.20 Pln | |
| Chemat | 25g | 10058.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
4,6-bis(4-fluorophenyl)pyrimidine (CAS 168915-00-2) is a chemical compound with the molecular formula C16H10F2N2 and a molecular weight of 268.26 g/mol. IUPAC name: 4,6-bis(4-fluorophenyl)pyrimidine. InChIKey: QHXSHRCALYKRKU-UHFFFAOYSA-N.
| Molecular formula | C16H10F2N2 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 4,6-bis(4-fluorophenyl)pyrimidine |
| InChIKey | QHXSHRCALYKRKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC=N2)C3=CC=C(C=C3)F)F |
Computed by PubChem (NCBI)