cas: 1379324-09-0 — see every product listed under this CAS number, including other names
4,6-DICHLORO-N-METHYL-2-PYRIDINECARBOXAMIDE, 97% (CAS 1379324-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844108-100MG |
| cas | 1379324-09-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 1080.89 Pln | |
| Fluorochem | 1g | 3637.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,6-dichloro-N-methylpyridine-2-carboxamide (CAS 1379324-09-0) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 4,6-dichloro-N-methylpyridine-2-carboxamide. InChIKey: IJWIURVNWMGRII-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 4,6-dichloro-N-methylpyridine-2-carboxamide |
| InChIKey | IJWIURVNWMGRII-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)