cas: 99429-80-8 — see every product listed under this CAS number, including other names
4,6-Dichlorothieno[2,3-b]pyridine 98% (CAS 99429-80-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A137163-250mg |
| cas | 99429-80-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 576.19 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A137163 |
4,6-dichlorothieno[2,3-b]pyridine (CAS 99429-80-8) is a chemical compound with the molecular formula C7H3Cl2NS and a molecular weight of 204.08 g/mol. IUPAC name: 4,6-dichlorothieno[2,3-b]pyridine. InChIKey: OUMURQZNFGBWAH-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NS |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 4,6-dichlorothieno[2,3-b]pyridine |
| InChIKey | OUMURQZNFGBWAH-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)