cas: 17654-70-5 — see every product listed under this CAS number, including other names
4,6-Difluoroisophthalonitrile, 98% (CAS 17654-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F693519-100MG |
| cas | 17654-70-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 3444.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,6-difluorobenzene-1,3-dicarbonitrile (CAS 17654-70-5) is a chemical compound with the molecular formula C8H2F2N2 and a molecular weight of 164.11 g/mol. IUPAC name: 4,6-difluorobenzene-1,3-dicarbonitrile. InChIKey: UAKXPKOAUDLYKN-UHFFFAOYSA-N.
| Molecular formula | C8H2F2N2 |
|---|---|
| Molecular weight | 164.11 g/mol |
| IUPAC name | 4,6-difluorobenzene-1,3-dicarbonitrile |
| InChIKey | UAKXPKOAUDLYKN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C#N)F)F)C#N |
Computed by PubChem (NCBI)