cas: 2097010-30-3 — see every product listed under this CAS number, including other names
4,7,10,13,16,19,22,25,28,31,34-Undecaoxaheptatriacontanedioic acid, 95%, 95% (CAS 2097010-30-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFVV-5g |
| cas | 2097010-30-3 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 11546.00 Pln | |
| Chemat | 100mg | 688.40 Pln | |
| Chemat | 250mg | 1125.20 Pln | |
| Chemat | 1g | 2934.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2097010-30-3) is a chemical compound with the molecular formula C26H50O15 and a molecular weight of 602.7 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: MMKYGEBIUHVZNI-UHFFFAOYSA-N.
| Molecular formula | C26H50O15 |
|---|---|
| Molecular weight | 602.7 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | MMKYGEBIUHVZNI-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)