cas: 2100306-58-7 — see every product listed under this CAS number, including other names
4,7,10,13-Tetraoxa-17-azaeicosanoic acid, 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-, 2,5-dioxo-1-pyrrolidinyl ester, 95%, 95% (CAS 2100306-58-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EEG-10mg |
| cas | 2100306-58-7 |
| size | 10mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 530.00 Pln | |
| Chemat | 25mg | 1034.00 Pln | |
| Chemat | 50mg | 1619.60 Pln | |
| Chemat | 100mg | 2522.00 Pln | |
| Chemat | 250mg | 4389.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2100306-58-7) is a chemical compound with the molecular formula C34H39N3O10 and a molecular weight of 649.7 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ZVWIDTHUTOSOEZ-UHFFFAOYSA-N.
| Molecular formula | C34H39N3O10 |
|---|---|
| Molecular weight | 649.7 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ZVWIDTHUTOSOEZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCC(=O)NCCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)