cas: 1807539-10-1 — see every product listed under this CAS number, including other names
4,7,14,17-Tetraoxa-10,11-dithiaicosanedioic acid, 95% (CAS 1807539-10-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867314-100MG |
| cas | 1807539-10-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2950.02 Pln | |
| Fluorochem | 250mg | 4532.80 Pln | |
| Fluorochem | 500mg | 6636.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyldisulfanyl]ethoxy]ethoxy]propanoic acid (CAS 1807539-10-1) is a chemical compound with the molecular formula C14H26O8S2 and a molecular weight of 386.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyldisulfanyl]ethoxy]ethoxy]propanoic acid. InChIKey: TZKZHEPGHNBGKD-UHFFFAOYSA-N.
| Molecular formula | C14H26O8S2 |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyldisulfanyl]ethoxy]ethoxy]propanoic acid |
| InChIKey | TZKZHEPGHNBGKD-UHFFFAOYSA-N |
| SMILES | C(COCCOCCSSCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)