4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c][1,2,5]thiadiazole, 95%
cas: 934365-16-9 — see every product listed under this CAS number, including other names
4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c][1,2,5]thiadiazole, 95% (CAS 934365-16-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A140865-250mg |
| cas | 934365-16-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 10g | 1482.88 Pln | |
| Ambeed | 25g | 3602.19 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 836.40 Pln | |
| BLDpharm | 10g | 1591.69 Pln | |
| BLDpharm | 25g | 3874.22 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole (CAS 934365-16-9) is a chemical compound with the molecular formula C18H26B2N2O4S and a molecular weight of 388.1 g/mol. IUPAC name: 4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole. InChIKey: DHWADSHFLSDMBJ-UHFFFAOYSA-N.
| Molecular formula | C18H26B2N2O4S |
|---|---|
| Molecular weight | 388.1 g/mol |
| IUPAC name | 4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole |
| InChIKey | DHWADSHFLSDMBJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=NSN=C23)B4OC(C(O4)(C)C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole, 4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c][1,2,5]thiadiazole, 2,1,3-Benzothiadiazole-4,7-bis(boronic acid pinacol ester), 2,1,3-Benzothiadiazole-4,7-diboronic acid, pinacol ester, 2,1,3-Benzothiadiazole-4,7-diboronic Acid Bis(pinacol) Ester, 47-Bis(4455-tetramethyl-132-dioxaborolan-2-yl)benzo[c][125]thiadiazole, 2,1,3-Benzothiadiazole-4,7-diboronic acid pinacol ester, Benzo[c]-1,2,3-thiadiazol-4,7-diyl-4,7-diboronic acid dipinacol ester, 2,1,3-Benzothiadiazole-4,7-bis(pinacolato)diboronic ester, 2,1,3-Benzothiadiazole-4,7-bis(boronic acid pinacol ester), 95%