CAS 1797404-58-0 is the registry number for 4,7-Dibromo-5,6-difluorobenzo[c][1,2,5]oxadiazole, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
4,7-dibromo-5,6-difluoro-2,1,3-benzoxadiazole (CAS 1797404-58-0) is a chemical compound with the molecular formula C6Br2F2N2O and a molecular weight of 313.88 g/mol. IUPAC name: 4,7-dibromo-5,6-difluoro-2,1,3-benzoxadiazole. InChIKey: GKKUHQQNQBVLSW-UHFFFAOYSA-N.
| Molecular formula | C6Br2F2N2O |
|---|---|
| Molecular weight | 313.88 g/mol |
| IUPAC name | 4,7-dibromo-5,6-difluoro-2,1,3-benzoxadiazole |
| InChIKey | GKKUHQQNQBVLSW-UHFFFAOYSA-N |
| SMILES | C1(=C(C2=NON=C2C(=C1F)Br)Br)F |
Computed by PubChem (NCBI)