CAS 1455435-88-7 appears in our catalog under these names: 4,7-Dibromo-5,6-difluorobenzo[c][1,2,5]selenadiazole, 97%, 97%, 4,7-Dibromo-5,6-difluorobenzo[c][1,2,5]selenadiazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4,7-dibromo-5,6-difluoro-2,1,3-benzoselenadiazole (CAS 1455435-88-7) is a chemical compound with the molecular formula C6Br2F2N2Se and a molecular weight of 376.85 g/mol. IUPAC name: 4,7-dibromo-5,6-difluoro-2,1,3-benzoselenadiazole. InChIKey: UAEHPCSMHDZSJW-UHFFFAOYSA-N.
| Molecular formula | C6Br2F2N2Se |
|---|---|
| Molecular weight | 376.85 g/mol |
| IUPAC name | 4,7-dibromo-5,6-difluoro-2,1,3-benzoselenadiazole |
| InChIKey | UAEHPCSMHDZSJW-UHFFFAOYSA-N |
| SMILES | C1(=C(C2=N[Se]N=C2C(=C1F)Br)Br)F |
Computed by PubChem (NCBI)