CAS 76186-72-6 appears in our catalog under these names: 4,7-Dibromo-5,6-dintiro-2,1,3-benzothiadiazole, 4,7–Dibromo–5,6–dinitrobenzo(c)(1,2,5)thiadiazole, 4,7-Dibromo-5,6-dinitro-2,1,3-benzothiadiazole, 4,7-Dibromo-5,6-dinitro-2,1,3-benzothiadiazole, >97.0%(HPLC), 4,7-DIBROMO-5,6-DINITROBENZO[C][1,2,5]THIADIAZOLE, 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Fluorochem. Available pack sizes: 750mg, 100g, 25g, 5g, 1g, 0,5g, 2g, 10g.
4,7-dibromo-5,6-dinitro-2,1,3-benzothiadiazole (CAS 76186-72-6) is a chemical compound with the molecular formula C6Br2N4O4S and a molecular weight of 383.96 g/mol. IUPAC name: 4,7-dibromo-5,6-dinitro-2,1,3-benzothiadiazole. InChIKey: XEVOZPRNEPMHAF-UHFFFAOYSA-N.
| Molecular formula | C6Br2N4O4S |
|---|---|
| Molecular weight | 383.96 g/mol |
| IUPAC name | 4,7-dibromo-5,6-dinitro-2,1,3-benzothiadiazole |
| InChIKey | XEVOZPRNEPMHAF-UHFFFAOYSA-N |
| SMILES | C1(=C(C2=NSN=C2C(=C1[N+](=O)[O-])Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)