4,7-Dibromobenzo[c][1,2,5]selenadiazole, 95%
cas: 63224-42-0 — see every product listed under this CAS number, including other names
4,7-Dibromobenzo[c][1,2,5]selenadiazole, 95% (CAS 63224-42-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | AG003KK2-100mg |
| cas | 63224-42-0 |
| size | 100mg |
| availability | 300g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 146.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 25g | 2138.00 Pln | |
| Chemat | 50g | 4005.20 Pln | |
| Chemat | 100g | 6088.40 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 146.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 25g | 2138.00 Pln | |
| Chemat | 50g | 4005.20 Pln | |
| Chemat | 100g | 6088.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,7-dibromo-2,1,3-benzoselenadiazole (CAS 63224-42-0) is a chemical compound with the molecular formula C6H2Br2N2Se and a molecular weight of 340.87 g/mol. IUPAC name: 4,7-dibromo-2,1,3-benzoselenadiazole. InChIKey: MVYRQFKGUCDJAB-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2Se |
|---|---|
| Molecular weight | 340.87 g/mol |
| IUPAC name | 4,7-dibromo-2,1,3-benzoselenadiazole |
| InChIKey | MVYRQFKGUCDJAB-UHFFFAOYSA-N |
| SMILES | C1=C(C2=N[Se]N=C2C(=C1)Br)Br |
Computed by PubChem (NCBI)