cas: 2585-18-4 — see every product listed under this CAS number, including other names
4,7-Dimethylquinolin-2(1H)-one 95+% (CAS 2585-18-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A758188-100mg |
| cas | 2585-18-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 598.44 Pln | |
| Ambeed | 1g | 1544.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A758188 |
4,7-dimethyl-1H-quinolin-2-one (CAS 2585-18-4) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 4,7-dimethyl-1H-quinolin-2-one. InChIKey: WFVZLFFKZBDDCM-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 4,7-dimethyl-1H-quinolin-2-one |
| InChIKey | WFVZLFFKZBDDCM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC(=O)N2)C |
Computed by PubChem (NCBI)