4,7-Diphenylbenzo[c][1,2,5]thiadiazole, 98%
cas: 287976-96-9 — see every product listed under this CAS number, including other names
4,7-Diphenylbenzo[c][1,2,5]thiadiazole, 98% (CAS 287976-96-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1905506-1g |
| cas | 287976-96-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 798.69 Pln | |
| Ambeed | 25g | 2506.38 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 1130.00 Pln | |
| Chemat | 25g | 1979.60 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 841.95 Pln | |
| BLDpharm | 25g | 2696.85 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4,7-diphenyl-2,1,3-benzothiadiazole (CAS 287976-96-9) is a chemical compound with the molecular formula C18H12N2S and a molecular weight of 288.4 g/mol. IUPAC name: 4,7-diphenyl-2,1,3-benzothiadiazole. InChIKey: BFTONFBWVCVMTD-UHFFFAOYSA-N.
| Molecular formula | C18H12N2S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4,7-diphenyl-2,1,3-benzothiadiazole |
| InChIKey | BFTONFBWVCVMTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C3=NSN=C23)C4=CC=CC=C4 |
Computed by PubChem (NCBI)