cas: 1070879-55-8 — see every product listed under this CAS number, including other names
4,8-Dibromo-2-methylquinoline, 99%, 99% (CAS 1070879-55-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11049N-100mg |
| cas | 1070879-55-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1634.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
4,8-dibromo-2-methylquinoline (CAS 1070879-55-8) is a chemical compound with the molecular formula C10H7Br2N and a molecular weight of 300.98 g/mol. IUPAC name: 4,8-dibromo-2-methylquinoline. InChIKey: ZTIXHNVOIKNFKE-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2N |
|---|---|
| Molecular weight | 300.98 g/mol |
| IUPAC name | 4,8-dibromo-2-methylquinoline |
| InChIKey | ZTIXHNVOIKNFKE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC=C(C2=N1)Br)Br |
Computed by PubChem (NCBI)