4,8-bis((2-Ethylhexyl)oxy)benzo[1,2-b:4,5-b']dithiophene, 97%
cas: 1160823-77-7 — see every product listed under this CAS number, including other names
4,8-bis((2-Ethylhexyl)oxy)benzo[1,2-b:4,5-b']dithiophene, 97% (CAS 1160823-77-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F568143-1G |
| cas | 1160823-77-7 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1117.33 Pln | |
| Fluorochem | 25g | 4746.26 Pln | |
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1126.88 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 875.60 Pln | |
| Chemat | 10g | 1600.40 Pln | |
| Chemat | 25g | 3597.20 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4,8-bis(2-ethylhexoxy)thieno[2,3-f][1]benzothiole (CAS 1160823-77-7) is a chemical compound with the molecular formula C26H38O2S2 and a molecular weight of 446.7 g/mol. IUPAC name: 4,8-bis(2-ethylhexoxy)thieno[2,3-f][1]benzothiole. InChIKey: HATOWNJGYIVNBU-UHFFFAOYSA-N.
| Molecular formula | C26H38O2S2 |
|---|---|
| Molecular weight | 446.7 g/mol |
| IUPAC name | 4,8-bis(2-ethylhexoxy)thieno[2,3-f][1]benzothiole |
| InChIKey | HATOWNJGYIVNBU-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC1=C2C=CSC2=C(C3=C1SC=C3)OCC(CC)CCCC |
Computed by PubChem (NCBI)