CAS 1209012-31-6 appears in our catalog under these names: 8,10-Dihydro-s-indaceno[1,2-b:6,7-b']dithiophene, 97%, 97%, 4,9-Dihydro-s-indaceno[1,2-b:5,6-b']dithiophene, 97%, IDT-CORE, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 50g, 100mg, 250mg, 1g, 5g.
5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene (CAS 1209012-31-6) is a chemical compound with the molecular formula C16H10S2 and a molecular weight of 266.4 g/mol. IUPAC name: 5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene. InChIKey: ZGQQWSXQDWUNDY-UHFFFAOYSA-N.
| Molecular formula | C16H10S2 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
| InChIKey | ZGQQWSXQDWUNDY-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC4=C(C=C31)C5=C(C4)C=CS5)SC=C2 |
Computed by PubChem (NCBI)