cas: 941717-06-2 — see every product listed under this CAS number, including other names
4-((2-(Bromomethyl)phenyl)sulfonyl)morpholine 95% (CAS 941717-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A501301-100mg |
| cas | 941717-06-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3791.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A501301 |
4-[2-(bromomethyl)phenyl]sulfonylmorpholine (CAS 941717-06-2) is a chemical compound with the molecular formula C11H14BrNO3S and a molecular weight of 320.20 g/mol. IUPAC name: 4-[2-(bromomethyl)phenyl]sulfonylmorpholine. InChIKey: VRRKTYLWVKMVJU-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO3S |
|---|---|
| Molecular weight | 320.20 g/mol |
| IUPAC name | 4-[2-(bromomethyl)phenyl]sulfonylmorpholine |
| InChIKey | VRRKTYLWVKMVJU-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=CC=C2CBr |
Computed by PubChem (NCBI)