cas: 7252-02-0 — see every product listed under this CAS number, including other names
4-((3,4-Dihydroisoquinolin-2(1H)-yl)sulfonyl)aniline 95% (CAS 7252-02-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A526863-250mg |
| cas | 7252-02-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 921.06 Pln | |
| Ambeed | 1g | 2189.31 Pln | |
| Ambeed | 50mg | 348.12 Pln | |
| Ambeed | 100mg | 542.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A526863 |
4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)aniline (CAS 7252-02-0) is a chemical compound with the molecular formula C15H16N2O2S and a molecular weight of 288.4 g/mol. IUPAC name: 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)aniline. InChIKey: PBWWVSWTXKQMEN-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)aniline |
| InChIKey | PBWWVSWTXKQMEN-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)S(=O)(=O)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)