cas: 330786-34-0 — see every product listed under this CAS number, including other names
4-((3-Chloro-4-methoxybenzyl)amino)-2-(methylthio)pyrimidine-5-carboxylic acid 95+% (CAS 330786-34-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A382844-5g |
| cas | 330786-34-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1282.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A382844 |
4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidine-5-carboxylic acid (CAS 330786-34-0) is a chemical compound with the molecular formula C14H14ClN3O3S and a molecular weight of 339.8 g/mol. IUPAC name: 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidine-5-carboxylic acid. InChIKey: PXYYGISXAWKTCT-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O3S |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 4-[(3-chloro-4-methoxyphenyl)methylamino]-2-methylsulfanylpyrimidine-5-carboxylic acid |
| InChIKey | PXYYGISXAWKTCT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CNC2=NC(=NC=C2C(=O)O)SC)Cl |
Computed by PubChem (NCBI)