CAS 2196195-87-4 is the registry number for 4-[(4-nitrophenoxy)carbonyl]phenyl 2,4-dimethoxybenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg.
[4-(4-nitrophenoxy)carbonylphenyl] 2,4-dimethoxybenzoate (CAS 2196195-87-4) is a chemical compound with the molecular formula C22H17NO8 and a molecular weight of 423.4 g/mol. IUPAC name: [4-(4-nitrophenoxy)carbonylphenyl] 2,4-dimethoxybenzoate. InChIKey: GTOBZXOWFFWRDY-UHFFFAOYSA-N.
| Molecular formula | C22H17NO8 |
|---|---|
| Molecular weight | 423.4 g/mol |
| IUPAC name | [4-(4-nitrophenoxy)carbonylphenyl] 2,4-dimethoxybenzoate |
| InChIKey | GTOBZXOWFFWRDY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)OC2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)