cas: 950603-39-1 — see every product listed under this CAS number, including other names
4-((5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)methyl)morpholine (CAS 950603-39-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216710-250MG |
| cas | 950603-39-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 1278.73 Pln |
| delivery time | 2-3 weeks |
|---|
4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine (CAS 950603-39-1) is a chemical compound with the molecular formula C15H24BNO3S and a molecular weight of 309.2 g/mol. IUPAC name: 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine. InChIKey: CNLWVADWZRQAFZ-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO3S |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]morpholine |
| InChIKey | CNLWVADWZRQAFZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CN3CCOCC3 |
Computed by PubChem (NCBI)