4-(1,2,2-Triphenylvinyl)pyridine, 97%
cas: 1877242-82-4 — see every product listed under this CAS number, including other names
4-(1,2,2-Triphenylvinyl)pyridine, 97% (CAS 1877242-82-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1494423-100mg |
| cas | 1877242-82-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 387.06 Pln | |
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1338.25 Pln | |
| Ambeed | 5g | 3880.31 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 753.09 Pln | |
| BLDpharm | 1g | 1441.74 Pln | |
| BLDpharm | 5g | 4179.66 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1158.80 Pln | |
| Chemat | 5g | 3352.40 Pln | |
| Fluorochem | 1g | 2143.01 Pln | |
| Fluorochem | 5g | 6224.91 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-(1,2,2-triphenylethenyl)pyridine (CAS 1877242-82-4) is a chemical compound with the molecular formula C25H19N and a molecular weight of 333.4 g/mol. IUPAC name: 4-(1,2,2-triphenylethenyl)pyridine. InChIKey: YQWDIRQVVHQZNI-UHFFFAOYSA-N.
| Molecular formula | C25H19N |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 4-(1,2,2-triphenylethenyl)pyridine |
| InChIKey | YQWDIRQVVHQZNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=NC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)