4-(2,6-Bis(benzyloxy)pyridin-3-yl)phenol, 98%
cas: 2758531-20-1 — see every product listed under this CAS number, including other names
4-(2,6-Bis(benzyloxy)pyridin-3-yl)phenol, 98% (CAS 2758531-20-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A2014858-250mg |
| cas | 2758531-20-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 865.44 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Ambeed | 5g | 6044.12 Pln | |
| BLDpharm | 100mg | 558.72 Pln | |
| BLDpharm | 250mg | 925.25 Pln | |
| BLDpharm | 1g | 1902.69 Pln | |
| BLDpharm | 5g | 5929.05 Pln | |
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 1389.20 Pln | |
| Fluorochem | 100mg | 549.82 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 1851.45 Pln | |
| Fluorochem | 5g | 6021.86 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenol (CAS 2758531-20-1) is a chemical compound with the molecular formula C25H21NO3 and a molecular weight of 383.4 g/mol. IUPAC name: 4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenol. InChIKey: FTUQDOHAUBZCGT-UHFFFAOYSA-N.
| Molecular formula | C25H21NO3 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenol |
| InChIKey | FTUQDOHAUBZCGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=C(C=C2)C3=CC=C(C=C3)O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)